C25H14Br2N2 — CID 118632511
4-[4-(3,6-dibromocarbazol-9-yl)phenyl]benzonitrile (PubChem CID 118632511) has the molecular formula C25H14Br2N2 and a molecular weight of 502.21 g/mol. Its IUPAC name is 4-[4-(3,6-dibromocarbazol-9-yl)phenyl]benzonitrile.
| Compound Name | 4-[4-(3,6-dibromocarbazol-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 118632511 |
| Molecular Formula | C25H14Br2N2 |
| Molecular Weight | 502.21 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | 4-[4-(3,6-dibromocarbazol-9-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-n3c4ccc(Br)cc4c4cc(Br)ccc43)cc2)cc1 |
| InChI | InChI=1S/C25H14Br2N2/c26-19-7-11-24-22(13-19)23-14-20(27)8-12-25(23)29(24)21-9-5-18(6-10-21)17-3-1-16(15-28)2-4-17/h1-14H |
| InChIKey | SJHZSRXLJFPBAC-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.21 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |