About 9-(4-bromophenyl)-3,6-diethynylcarbazole
9-(4-bromophenyl)-3,6-diethynylcarbazole (PubChem CID 25185238) has the molecular formula C22H12BrN
and a molecular weight of 370.25 g/mol. Its IUPAC name is 9-(4-bromophenyl)-3,6-diethynylcarbazole.
Molecular Properties
| Compound Name | 9-(4-bromophenyl)-3,6-diethynylcarbazole |
| PubChem CID | 25185238 |
| Molecular Formula | C22H12BrN |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 9-(4-bromophenyl)-3,6-diethynylcarbazole |
| SMILES | C#Cc1ccc2c(c1)c1cc(C#C)ccc1n2-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H12BrN/c1-3-15-5-11-21-19(13-15)20-14-16(4-2)6-12-22(20)24(21)18-9-7-17(23)8-10-18/h1-2,5-14H |
| InChIKey | XYDWPJHSZURFJW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-bromophenyl)-3,6-diethynylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-bromophenyl)-3,6-diethynylcarbazole?
The IUPAC name of 9-(4-bromophenyl)-3,6-diethynylcarbazole (CID 25185238) is 9-(4-bromophenyl)-3,6-diethynylcarbazole.
What is the SMILES notation for 9-(4-bromophenyl)-3,6-diethynylcarbazole?
The canonical SMILES for 9-(4-bromophenyl)-3,6-diethynylcarbazole is C#Cc1ccc2c(c1)c1cc(C#C)ccc1n2-c1ccc(Br)cc1.
What is the InChIKey of 9-(4-bromophenyl)-3,6-diethynylcarbazole?
The InChIKey is XYDWPJHSZURFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12BrN/c1-3-15-5-11-21-19(13-15)20-14-16(4-2)6-12-22(20)24(21)18-9-7-17(23)8-10-18/h1-2,5-14H.
What are the key properties of 9-(4-bromophenyl)-3,6-diethynylcarbazole?
9-(4-bromophenyl)-3,6-diethynylcarbazole has a molecular weight of 370.25 g/mol, XLogP of 5.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-bromophenyl)-3,6-diethynylcarbazole is sourced from PubChem (CID 25185238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).