C14H13N — CID 178022699
1-(4-ethynylphenyl)-2,5-dimethylpyrrole (PubChem CID 178022699) has the molecular formula C14H13N and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(4-ethynylphenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(4-ethynylphenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 178022699 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-(4-ethynylphenyl)-2,5-dimethylpyrrole |
| SMILES | C#Cc1ccc(-n2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C14H13N/c1-4-13-7-9-14(10-8-13)15-11(2)5-6-12(15)3/h1,5-10H,2-3H3 |
| InChIKey | KRXALQGYZZHHRO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|