C10H9N3 — CID 170434529
3-(4-ethynylphenyl)-1,2-dihydrotriazole (PubChem CID 170434529) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-(4-ethynylphenyl)-1,2-dihydrotriazole.
| Compound Name | 3-(4-ethynylphenyl)-1,2-dihydrotriazole |
|---|---|
| PubChem CID | 170434529 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-(4-ethynylphenyl)-1,2-dihydrotriazole |
| SMILES | C#Cc1ccc(N2C=CNN2)cc1 |
| InChI | InChI=1S/C10H9N3/c1-2-9-3-5-10(6-4-9)13-8-7-11-12-13/h1,3-8,11-12H |
| InChIKey | ALQFVJNELKHJPO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|