About 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile
4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile (PubChem CID 153386757) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile.
Molecular Properties
| Compound Name | 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile |
| PubChem CID | 153386757 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile |
| SMILES | C#N.Cc1ccc(C(=O)C2CCC2)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H16N2O.CHN/c1-12-5-10-16(17(20)14-3-2-4-14)19(12)15-8-6-13(11-18)7-9-15;1-2/h5-10,14H,2-4H2,1H3;1H |
| InChIKey | XDIGYBBKYYYYHR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile?
The IUPAC name of 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile (CID 153386757) is 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile.
What is the SMILES notation for 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile?
The canonical SMILES for 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile is C#N.Cc1ccc(C(=O)C2CCC2)n1-c1ccc(C#N)cc1.
What is the InChIKey of 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile?
The InChIKey is XDIGYBBKYYYYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O.CHN/c1-12-5-10-16(17(20)14-3-2-4-14)19(12)15-8-6-13(11-18)7-9-15;1-2/h5-10,14H,2-4H2,1H3;1H.
What are the key properties of 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile?
4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile has a molecular weight of 291.35 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(cyclobutanecarbonyl)-5-methylpyrrol-1-yl]benzonitrile;formonitrile is sourced from PubChem (CID 153386757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).