About cyclopentanol;4-methylbenzonitrile
cyclopentanol;4-methylbenzonitrile (PubChem CID 144616073) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is cyclopentanol;4-methylbenzonitrile.
Molecular Properties
| Compound Name | cyclopentanol;4-methylbenzonitrile |
| PubChem CID | 144616073 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | cyclopentanol;4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1.OC1CCCC1 |
| InChI | InChI=1S/C8H7N.C5H10O/c1-7-2-4-8(6-9)5-3-7;6-5-3-1-2-4-5/h2-5H,1H3;5-6H,1-4H2 |
| InChIKey | VHTFXLYJAUQLFN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentanol;4-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanol;4-methylbenzonitrile?
The IUPAC name of cyclopentanol;4-methylbenzonitrile (CID 144616073) is cyclopentanol;4-methylbenzonitrile.
What is the SMILES notation for cyclopentanol;4-methylbenzonitrile?
The canonical SMILES for cyclopentanol;4-methylbenzonitrile is Cc1ccc(C#N)cc1.OC1CCCC1.
What is the InChIKey of cyclopentanol;4-methylbenzonitrile?
The InChIKey is VHTFXLYJAUQLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C5H10O/c1-7-2-4-8(6-9)5-3-7;6-5-3-1-2-4-5/h2-5H,1H3;5-6H,1-4H2.
What are the key properties of cyclopentanol;4-methylbenzonitrile?
cyclopentanol;4-methylbenzonitrile has a molecular weight of 203.29 g/mol, XLogP of 2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanol;4-methylbenzonitrile is sourced from PubChem (CID 144616073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).