C22H27N — CID 167273285
4-[2,5-dimethyl-5-(4-methylphenyl)hexan-2-yl]benzonitrile (PubChem CID 167273285) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-[2,5-dimethyl-5-(4-methylphenyl)hexan-2-yl]benzonitrile.
| Compound Name | 4-[2,5-dimethyl-5-(4-methylphenyl)hexan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 167273285 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-[2,5-dimethyl-5-(4-methylphenyl)hexan-2-yl]benzonitrile |
| SMILES | Cc1ccc(C(C)(C)CCC(C)(C)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H27N/c1-17-6-10-19(11-7-17)21(2,3)14-15-22(4,5)20-12-8-18(16-23)9-13-20/h6-13H,14-15H2,1-5H3 |
| InChIKey | BJHDIDHMKCDSEU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |