C60H54N4 — CID 139553206
4-[5-(4-cyanophenyl)-2,4-dicyclohexyl-3,6-bis(3,6-dimethylcarbazol-9-yl)phenyl]benzonitrile (PubChem CID 139553206) has the molecular formula C60H54N4 and a molecular weight of 831.12 g/mol. Its IUPAC name is 4-[5-(4-cyanophenyl)-2,4-dicyclohexyl-3,6-bis(3,6-dimethylcarbazol-9-yl)phenyl]benzonitrile.
| Compound Name | 4-[5-(4-cyanophenyl)-2,4-dicyclohexyl-3,6-bis(3,6-dimethylcarbazol-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139553206 |
| Molecular Formula | C60H54N4 |
| Molecular Weight | 831.12 g/mol |
| Exact Mass | 830.43 |
| IUPAC Name | 4-[5-(4-cyanophenyl)-2,4-dicyclohexyl-3,6-bis(3,6-dimethylcarbazol-9-yl)phenyl]benzonitrile |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1c(-c2ccc(C#N)cc2)c(C2CCCCC2)c(-n2c3ccc(C)cc3c3cc(C)ccc32)c(C2CCCCC2)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C60H54N4/c1-37-15-27-51-47(31-37)48-32-38(2)16-28-52(48)63(51)59-55(43-11-7-5-8-12-43)57(45-23-19-41(35-61)20-24-45)60(64-53-29-17-39(3)33-49(53)50-34-40(4)18-30-54(50)64)58(46-25-21-42(36-62)22-26-46)56(59)44-13-9-6-10-14-44/h15-34,43-44H,5-14H2,1-4H3 |
| InChIKey | LRHWSIPJHRYZSP-UHFFFAOYSA-N |
| XLogP | 16.29 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.12 |
| LogP ≤ 5 | 16.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |