C48H34N4 — CID 166047050
2,5-bis(3,6-dimethylcarbazol-9-yl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)benzene-1,4-dicarbonitrile (PubChem CID 166047050) has the molecular formula C48H34N4 and a molecular weight of 676.89 g/mol. Its IUPAC name is 2,5-bis(3,6-dimethylcarbazol-9-yl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis(3,6-dimethylcarbazol-9-yl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 166047050 |
| Molecular Formula | C48H34N4 |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | 2,5-bis(3,6-dimethylcarbazol-9-yl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)benzene-1,4-dicarbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C#N)c(-n3c4ccc(C)cc4c4cc(C)ccc43)c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c(C#N)c2-n2c3ccc(C)cc3c3cc(C)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C48H34N4/c1-29-15-19-41-35(23-29)36-24-30(2)16-20-42(36)51(41)47-39(27-49)46(34-13-9-6-10-14-34)48(40(28-50)45(47)33-11-7-5-8-12-33)52-43-21-17-31(3)25-37(43)38-26-32(4)18-22-44(38)52/h5-26H,1-4H3/i5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
| InChIKey | YJPMYPRLMNLZLK-FBOMCFBCSA-N |
| XLogP | 12.19 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |