C59H44N4 — CID 137369299
2,6-bis(3,6-dimethylcarbazol-9-yl)-3,5-diphenyl-4-(N-phenylanilino)benzonitrile (PubChem CID 137369299) has the molecular formula C59H44N4 and a molecular weight of 809.03 g/mol. Its IUPAC name is 2,6-bis(3,6-dimethylcarbazol-9-yl)-3,5-diphenyl-4-(N-phenylanilino)benzonitrile.
| Compound Name | 2,6-bis(3,6-dimethylcarbazol-9-yl)-3,5-diphenyl-4-(N-phenylanilino)benzonitrile |
|---|---|
| PubChem CID | 137369299 |
| Molecular Formula | C59H44N4 |
| Molecular Weight | 809.03 g/mol |
| Exact Mass | 808.36 |
| IUPAC Name | 2,6-bis(3,6-dimethylcarbazol-9-yl)-3,5-diphenyl-4-(N-phenylanilino)benzonitrile |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1c(C#N)c(-n2c3ccc(C)cc3c3cc(C)ccc32)c(-c2ccccc2)c(N(c2ccccc2)c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C59H44N4/c1-38-25-29-51-46(33-38)47-34-39(2)26-30-52(47)62(51)57-50(37-60)58(63-53-31-27-40(3)35-48(53)49-36-41(4)28-32-54(49)63)56(43-19-11-6-12-20-43)59(55(57)42-17-9-5-10-18-42)61(44-21-13-7-14-22-44)45-23-15-8-16-24-45/h5-36H,1-4H3 |
| InChIKey | IWTRMGHHIASVSJ-UHFFFAOYSA-N |
| XLogP | 15.79 |
| TPSA | 36.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.03 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |