About 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile
4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile (PubChem CID 124606731) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile |
| PubChem CID | 124606731 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H]3CCC[C@@H](C2)C3O)cc1 |
| InChI | InChI=1S/C15H18N2O/c16-8-11-4-6-14(7-5-11)17-9-12-2-1-3-13(10-17)15(12)18/h4-7,12-13,15,18H,1-3,9-10H2/t12-,13+,15? |
| InChIKey | YVFQBDDQGIQZJP-NNQSOWQGSA-N |
| XLogP | 2.16 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile?
The IUPAC name of 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile (CID 124606731) is 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile.
What is the SMILES notation for 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile?
The canonical SMILES for 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile is N#Cc1ccc(N2C[C@H]3CCC[C@@H](C2)C3O)cc1.
What is the InChIKey of 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile?
The InChIKey is YVFQBDDQGIQZJP-NNQSOWQGSA-N. The full InChI is InChI=1S/C15H18N2O/c16-8-11-4-6-14(7-5-11)17-9-12-2-1-3-13(10-17)15(12)18/h4-7,12-13,15,18H,1-3,9-10H2/t12-,13+,15?.
What are the key properties of 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile?
4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile has a molecular weight of 242.32 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,5S)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]benzonitrile is sourced from PubChem (CID 124606731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).