C13H14N2 — CID 117045339
4-(2-azabicyclo[4.1.0]heptan-2-yl)benzonitrile (PubChem CID 117045339) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-(2-azabicyclo[4.1.0]heptan-2-yl)benzonitrile.
| Compound Name | 4-(2-azabicyclo[4.1.0]heptan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 117045339 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-(2-azabicyclo[4.1.0]heptan-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCC3CC32)cc1 |
| InChI | InChI=1S/C13H14N2/c14-9-10-3-5-12(6-4-10)15-7-1-2-11-8-13(11)15/h3-6,11,13H,1-2,7-8H2 |
| InChIKey | FJSBGJDXMOFBLV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |