C25H24N2O — CID 146425021
bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone (PubChem CID 146425021) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone.
| Compound Name | bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 146425021 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O/c1-17-5-6-18(2)26(17)23-13-9-21(10-14-23)25(28)22-11-15-24(16-12-22)27-19(3)7-8-20(27)4/h5-16H,1-4H3 |
| InChIKey | JGLWAZNWRPASCH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|