C19H20N4O — CID 2348439
4-(2,5-dimethylpyrrol-1-yl)-N'-[1-(1H-pyrrol-2-yl)ethenyl]benzohydrazide (PubChem CID 2348439) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N'-[1-(1H-pyrrol-2-yl)ethenyl]benzohydrazide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N'-[1-(1H-pyrrol-2-yl)ethenyl]benzohydrazide |
|---|---|
| PubChem CID | 2348439 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N'-[1-(1H-pyrrol-2-yl)ethenyl]benzohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(-n2c(C)ccc2C)cc1)c1ccc[nH]1 |
| InChI | InChI=1S/C19H20N4O/c1-13-6-7-14(2)23(13)17-10-8-16(9-11-17)19(24)22-21-15(3)18-5-4-12-20-18/h4-12,20-21H,3H2,1-2H3,(H,22,24) |
| InChIKey | HIHHJUIVWQRVGP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|