C21H22N4OS — CID 2728279
1-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 2728279) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 2728279 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[[4-(2,5-dimethylpyrrol-1-yl)benzoyl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C21H22N4OS/c1-14-4-10-18(11-5-14)22-21(27)24-23-20(26)17-8-12-19(13-9-17)25-15(2)6-7-16(25)3/h4-13H,1-3H3,(H,23,26)(H2,22,24,27) |
| InChIKey | FNIVNDDMOQEYIU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|