C22H20BrN3O4 — CID 17260334
[2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 17260334) has the molecular formula C22H20BrN3O4 and a molecular weight of 470.32 g/mol. Its IUPAC name is [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 17260334 |
| Molecular Formula | C22H20BrN3O4 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-[2-(4-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)OCC(=O)NNC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H20BrN3O4/c1-14-3-4-15(2)26(14)19-11-7-17(8-12-19)22(29)30-13-20(27)24-25-21(28)16-5-9-18(23)10-6-16/h3-12H,13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | XYHGYBRGOGUJPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|