C18H19N3O3 — CID 40552411
[2-(2-cyanoethylamino)-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 40552411) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 40552411 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)OCC(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C18H19N3O3/c1-13-4-5-14(2)21(13)16-8-6-15(7-9-16)18(23)24-12-17(22)20-11-3-10-19/h4-9H,3,11-12H2,1-2H3,(H,20,22) |
| InChIKey | GLXYFMDDNSFGIV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|