C13H15N3O4 — CID 104784363
[2-(2-cyanoethylamino)-2-oxoethyl] 4-amino-3-methoxybenzoate (PubChem CID 104784363) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 4-amino-3-methoxybenzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 4-amino-3-methoxybenzoate |
|---|---|
| PubChem CID | 104784363 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 4-amino-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NCCC#N)ccc1N |
| InChI | InChI=1S/C13H15N3O4/c1-19-11-7-9(3-4-10(11)15)13(18)20-8-12(17)16-6-2-5-14/h3-4,7H,2,6,8,15H2,1H3,(H,16,17) |
| InChIKey | PXUZDSBGMIHZLC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|