C13H15N3O4 — CID 43380279
methyl 3-amino-4-[2-(2-cyanoethylamino)-2-oxoethoxy]benzoate (PubChem CID 43380279) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 3-amino-4-[2-(2-cyanoethylamino)-2-oxoethoxy]benzoate.
| Compound Name | methyl 3-amino-4-[2-(2-cyanoethylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 43380279 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | methyl 3-amino-4-[2-(2-cyanoethylamino)-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)NCCC#N)c(N)c1 |
| InChI | InChI=1S/C13H15N3O4/c1-19-13(18)9-3-4-11(10(15)7-9)20-8-12(17)16-6-2-5-14/h3-4,7H,2,6,8,15H2,1H3,(H,16,17) |
| InChIKey | GYUXQRQZDUSVFD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|