C12H12FN3O3 — CID 61321672
[2-(2-cyanoethylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate (PubChem CID 61321672) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 61321672 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 3-amino-4-fluorobenzoate |
| SMILES | N#CCCNC(=O)COC(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C12H12FN3O3/c13-9-3-2-8(6-10(9)15)12(18)19-7-11(17)16-5-1-4-14/h2-3,6H,1,5,7,15H2,(H,16,17) |
| InChIKey | QELWQFBXIACCRX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|