C12H10ClFN2O3 — CID 8764105
[2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate (PubChem CID 8764105) has the molecular formula C12H10ClFN2O3 and a molecular weight of 284.67 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 8764105 |
| Molecular Formula | C12H10ClFN2O3 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate |
| SMILES | N#CCCNC(=O)COC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H10ClFN2O3/c13-10-6-8(14)2-3-9(10)12(18)19-7-11(17)16-5-1-4-15/h2-3,6H,1,5,7H2,(H,16,17) |
| InChIKey | RLPZXMZOGICYFG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|