C12H11ClFNO3 — CID 2570348
[2-(cyclopropylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate (PubChem CID 2570348) has the molecular formula C12H11ClFNO3 and a molecular weight of 271.67 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 2570348 |
| Molecular Formula | C12H11ClFNO3 |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-chloro-4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C12H11ClFNO3/c13-10-5-7(14)1-4-9(10)12(17)18-6-11(16)15-8-2-3-8/h1,4-5,8H,2-3,6H2,(H,15,16) |
| InChIKey | APOJXDQOMFRVLW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |