C13H12F2N2O4 — CID 7609118
[2-(2-cyanoethylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate (PubChem CID 7609118) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.24 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7609118 |
| Molecular Formula | C13H12F2N2O4 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
| SMILES | N#CCCNC(=O)COC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C13H12F2N2O4/c14-13(15)21-10-5-2-1-4-9(10)12(19)20-8-11(18)17-7-3-6-16/h1-2,4-5,13H,3,7-8H2,(H,17,18) |
| InChIKey | BMRLLKWFBYRJBJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|