C20H20F2N2O5 — CID 8581015
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(difluoromethoxy)benzoate (PubChem CID 8581015) has the molecular formula C20H20F2N2O5 and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 8581015 |
| Molecular Formula | C20H20F2N2O5 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-(difluoromethoxy)benzoate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)COC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H20F2N2O5/c1-2-13-7-3-5-9-15(13)24-17(25)11-23-18(26)12-28-19(27)14-8-4-6-10-16(14)29-20(21)22/h3-10,20H,2,11-12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | MIRDGDMTNRZKII-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |