C17H17BrN2O5 — CID 9201594
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 9201594) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 9201594 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)COC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H17BrN2O5/c1-2-11-5-3-4-6-12(11)20-15(21)9-19-16(22)10-24-17(23)13-7-8-14(18)25-13/h3-8H,2,9-10H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | GXXAXGNWWGSXCE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |