C25H32N2O4 — CID 8626175
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate (PubChem CID 8626175) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate |
|---|---|
| PubChem CID | 8626175 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(4-tert-butylphenyl)propanoate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)COC(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-5-19-8-6-7-9-21(19)27-22(28)16-26-23(29)17-31-24(30)15-12-18-10-13-20(14-11-18)25(2,3)4/h6-11,13-14H,5,12,15-17H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | QYGPHCSCTHDPJA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |