C19H26N2O4 — CID 9202919
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 9202919) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 9202919 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)COC(=O)CC1CCCC1 |
| InChI | InChI=1S/C19H26N2O4/c1-2-15-9-5-6-10-16(15)21-17(22)12-20-18(23)13-25-19(24)11-14-7-3-4-8-14/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZULPNRDYLZYGKM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |