C18H28N3O2+ — CID 8623341
N-(2-ethylphenyl)-2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]acetamide (PubChem CID 8623341) has the molecular formula C18H28N3O2+ and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 8623341 |
| Molecular Formula | C18H28N3O2+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | N-(2-ethylphenyl)-2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]acetamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)C[NH+]1CCCC[C@@H]1C |
| InChI | InChI=1S/C18H27N3O2/c1-3-15-9-4-5-10-16(15)20-17(22)12-19-18(23)13-21-11-7-6-8-14(21)2/h4-5,9-10,14H,3,6-8,11-13H2,1-2H3,(H,19,23)(H,20,22)/p+1/t14-/m0/s1 |
| InChIKey | RXNUVMVJXPYGOE-AWEZNQCLSA-O |
| XLogP | 0.76 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |