C21H26N3O2+ — CID 8583080
2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]-N-phenylbenzamide (PubChem CID 8583080) has the molecular formula C21H26N3O2+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 8583080 |
| Molecular Formula | C21H26N3O2+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[[2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetyl]amino]-N-phenylbenzamide |
| SMILES | C[C@H]1CCCC[NH+]1CC(=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-16-9-7-8-14-24(16)15-20(25)23-19-13-6-5-12-18(19)21(26)22-17-10-3-2-4-11-17/h2-6,10-13,16H,7-9,14-15H2,1H3,(H,22,26)(H,23,25)/p+1/t16-/m0/s1 |
| InChIKey | URMOFTBHJCJGHX-INIZCTEOSA-O |
| XLogP | 2.33 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |