C15H20F3N2O+ — CID 8583312
2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 8583312) has the molecular formula C15H20F3N2O+ and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8583312 |
| Molecular Formula | C15H20F3N2O+ |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | C[C@@H]1CCCC[NH+]1CC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O/c1-11-4-2-3-9-20(11)10-14(21)19-13-7-5-12(6-8-13)15(16,17)18/h5-8,11H,2-4,9-10H2,1H3,(H,19,21)/p+1/t11-/m1/s1 |
| InChIKey | BDROAGWGPAMHAE-LLVKDONJSA-O |
| XLogP | 2.10 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |