C16H22N3OS+ — CID 8583118
N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 8583118) has the molecular formula C16H22N3OS+ and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8583118 |
| Molecular Formula | C16H22N3OS+ |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2S)-2-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@H]1CCCC[NH+]1CC(=O)Nc1ccccc1SCC#N |
| InChI | InChI=1S/C16H21N3OS/c1-13-6-4-5-10-19(13)12-16(20)18-14-7-2-3-8-15(14)21-11-9-17/h2-3,7-8,13H,4-6,10-12H2,1H3,(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | SLEARDQHCLCIDR-ZDUSSCGKSA-O |
| XLogP | 1.70 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |