C24H28N4O2S — CID 60539219
4-[[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]amino]-N-cyclohexyl-3-methylbenzamide (PubChem CID 60539219) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 4-[[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]amino]-N-cyclohexyl-3-methylbenzamide.
| Compound Name | 4-[[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]amino]-N-cyclohexyl-3-methylbenzamide |
|---|---|
| PubChem CID | 60539219 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]amino]-N-cyclohexyl-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)ccc1NCC(=O)Nc1ccccc1SCC#N |
| InChI | InChI=1S/C24H28N4O2S/c1-17-15-18(24(30)27-19-7-3-2-4-8-19)11-12-20(17)26-16-23(29)28-21-9-5-6-10-22(21)31-14-13-25/h5-6,9-12,15,19,26H,2-4,7-8,14,16H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | OBFSIFUHLXGDPJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |