C17H23NO4 — CID 2617314
[2-(2-ethoxyanilino)-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 2617314) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 2617314 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)CC1CCCC1 |
| InChI | InChI=1S/C17H23NO4/c1-2-21-15-10-6-5-9-14(15)18-16(19)12-22-17(20)11-13-7-3-4-8-13/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3,(H,18,19) |
| InChIKey | BWXJYYMYOWJPCI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |