C16H21NO6S — CID 8735495
[2-(2-ethoxyanilino)-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8735495) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8735495 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[(3R)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21NO6S/c1-2-22-14-6-4-3-5-13(14)17-15(18)10-23-16(19)9-12-7-8-24(20,21)11-12/h3-6,12H,2,7-11H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | SENODTOHPBMJAN-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |