C15H19NO5S — CID 8735319
[2-(benzylamino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8735319) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8735319 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1CCS(=O)(=O)C1)NCc1ccccc1 |
| InChI | InChI=1S/C15H19NO5S/c17-14(16-9-12-4-2-1-3-5-12)10-21-15(18)8-13-6-7-22(19,20)11-13/h1-5,13H,6-11H2,(H,16,17)/t13-/m1/s1 |
| InChIKey | DCUKGXBTBAZWOE-CYBMUJFWSA-N |
| XLogP | 0.67 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |