C14H19NO3S — CID 110850619
N-benzyl-2-(1,1-dioxothian-3-yl)acetamide (PubChem CID 110850619) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-benzyl-2-(1,1-dioxothian-3-yl)acetamide.
| Compound Name | N-benzyl-2-(1,1-dioxothian-3-yl)acetamide |
|---|---|
| PubChem CID | 110850619 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-benzyl-2-(1,1-dioxothian-3-yl)acetamide |
| SMILES | O=C(CC1CCCS(=O)(=O)C1)NCc1ccccc1 |
| InChI | InChI=1S/C14H19NO3S/c16-14(15-10-12-5-2-1-3-6-12)9-13-7-4-8-19(17,18)11-13/h1-3,5-6,13H,4,7-11H2,(H,15,16) |
| InChIKey | QFCXYMOEMDEEKR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |