C12H16N2O3S — CID 86907941
2-(1,1-dioxothiolan-3-yl)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 86907941) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 86907941 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NCc1ccccn1 |
| InChI | InChI=1S/C12H16N2O3S/c15-12(7-10-4-6-18(16,17)9-10)14-8-11-3-1-2-5-13-11/h1-3,5,10H,4,6-9H2,(H,14,15) |
| InChIKey | WYDCMMKOSMGKBU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |