C15H21N3O4S — CID 108947458
N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-(pyridin-2-ylmethyl)propanediamide (PubChem CID 108947458) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-(pyridin-2-ylmethyl)propanediamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-(pyridin-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108947458 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-(pyridin-2-ylmethyl)propanediamide |
| SMILES | CCN(C(=O)CC(=O)NCc1ccccn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21N3O4S/c1-2-18(13-6-8-23(21,22)11-13)15(20)9-14(19)17-10-12-5-3-4-7-16-12/h3-5,7,13H,2,6,8-11H2,1H3,(H,17,19) |
| InChIKey | XNZOWMDRHRWIQK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|