C17H24N2O4S — CID 108945732
N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-[(4-methylphenyl)methyl]propanediamide (PubChem CID 108945732) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-[(4-methylphenyl)methyl]propanediamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-[(4-methylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 108945732 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-[(4-methylphenyl)methyl]propanediamide |
| SMILES | CCN(C(=O)CC(=O)NCc1ccc(C)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O4S/c1-3-19(15-8-9-24(22,23)12-15)17(21)10-16(20)18-11-14-6-4-13(2)5-7-14/h4-7,15H,3,8-12H2,1-2H3,(H,18,20) |
| InChIKey | OJDXSZYXUPBWKZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|