C17H18N2O5S2 — CID 42362615
4-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 42362615) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42362615 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccc(S(=O)(=O)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H18N2O5S2/c20-17(19-11-14-3-1-2-9-18-14)13-4-6-15(7-5-13)26(23,24)16-8-10-25(21,22)12-16/h1-7,9,16H,8,10-12H2,(H,19,20)/t16-/m0/s1 |
| InChIKey | JJZKTOJZTRDELU-INIZCTEOSA-N |
| XLogP | 0.97 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |