C15H21NO5S2 — CID 42362463
4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-methylpropyl)benzamide (PubChem CID 42362463) has the molecular formula C15H21NO5S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-methylpropyl)benzamide.
| Compound Name | 4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 42362463 |
| Molecular Formula | C15H21NO5S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H21NO5S2/c1-11(2)9-16-15(17)12-3-5-13(6-4-12)23(20,21)14-7-8-22(18,19)10-14/h3-6,11,14H,7-10H2,1-2H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | BVLXHVMZLLOMDM-CQSZACIVSA-N |
| XLogP | 1.03 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |