C14H18FNO6S2 — CID 42364055
5-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 42364055) has the molecular formula C14H18FNO6S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is 5-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 5-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42364055 |
| Molecular Formula | C14H18FNO6S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)ccc1F |
| InChI | InChI=1S/C14H18FNO6S2/c1-22-6-5-16-14(17)12-8-10(2-3-13(12)15)24(20,21)11-4-7-23(18,19)9-11/h2-3,8,11H,4-7,9H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | JGOAAVXMHMLZBB-LLVKDONJSA-N |
| XLogP | 0.16 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|