C17H15ClFNO5S2 — CID 42364505
N-(3-chlorophenyl)-5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluorobenzamide (PubChem CID 42364505) has the molecular formula C17H15ClFNO5S2 and a molecular weight of 431.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluorobenzamide.
| Compound Name | N-(3-chlorophenyl)-5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 42364505 |
| Molecular Formula | C17H15ClFNO5S2 |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | N-(3-chlorophenyl)-5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluorobenzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc(S(=O)(=O)[C@H]2CCS(=O)(=O)C2)ccc1F |
| InChI | InChI=1S/C17H15ClFNO5S2/c18-11-2-1-3-12(8-11)20-17(21)15-9-13(4-5-16(15)19)27(24,25)14-6-7-26(22,23)10-14/h1-5,8-9,14H,6-7,10H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | YPZQKGZKPLBIEU-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |