C16H15Cl2NO6S3 — CID 38996892
N-(2,4-dichlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide (PubChem CID 38996892) has the molecular formula C16H15Cl2NO6S3 and a molecular weight of 484.40 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 38996892 |
| Molecular Formula | C16H15Cl2NO6S3 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 482.94 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzenesulfonamide |
| SMILES | O=S1(=O)CC[C@@H](S(=O)(=O)c2cccc(S(=O)(=O)Nc3ccc(Cl)cc3Cl)c2)C1 |
| InChI | InChI=1S/C16H15Cl2NO6S3/c17-11-4-5-16(15(18)8-11)19-28(24,25)13-3-1-2-12(9-13)27(22,23)14-6-7-26(20,21)10-14/h1-5,8-9,14,19H,6-7,10H2/t14-/m1/s1 |
| InChIKey | BPZXHZOEQGHUOC-CQSZACIVSA-N |
| XLogP | 2.76 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |