C10H12ClNO4S2 — CID 81181045
4-chloro-2-(1,1-dioxothiolan-3-yl)sulfonylaniline (PubChem CID 81181045) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-chloro-2-(1,1-dioxothiolan-3-yl)sulfonylaniline.
| Compound Name | 4-chloro-2-(1,1-dioxothiolan-3-yl)sulfonylaniline |
|---|---|
| PubChem CID | 81181045 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4-chloro-2-(1,1-dioxothiolan-3-yl)sulfonylaniline |
| SMILES | Nc1ccc(Cl)cc1S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12ClNO4S2/c11-7-1-2-9(12)10(5-7)18(15,16)8-3-4-17(13,14)6-8/h1-2,5,8H,3-4,6,12H2 |
| InChIKey | UUTAIGPEXZSTIR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|