C11H10Cl2O6S2 — CID 61057559
2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid (PubChem CID 61057559) has the molecular formula C11H10Cl2O6S2 and a molecular weight of 373.24 g/mol. Its IUPAC name is 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid.
| Compound Name | 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 61057559 |
| Molecular Formula | C11H10Cl2O6S2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)C2CCS(=O)(=O)C2)c1Cl |
| InChI | InChI=1S/C11H10Cl2O6S2/c12-6-3-8(11(14)15)10(13)9(4-6)21(18,19)7-1-2-20(16,17)5-7/h3-4,7H,1-2,5H2,(H,14,15) |
| InChIKey | DMNXDIXKPQESCT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |