2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid

C11H10Cl2O6S2 — CID 61057559

IUPAC2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid
SMILESO=C(O)c1cc(Cl)cc(S(=O)(=O)C2CCS(=O)(=O)C2)c1Cl
InChIInChI=1S/C11H10Cl2O6S2/c12-6-3-8(11(14)15)10(13)9(4-6)21(18,19)7-1-2-20(16,17)5-7/h3-4,7H,1-2,5H2,(H,14,15)
InChIKeyDMNXDIXKPQESCT-UHFFFAOYSA-N
MW373.24 g/mol
LogP1.65
Rot. Bonds3

About 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid

2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid (PubChem CID 61057559) has the molecular formula C11H10Cl2O6S2 and a molecular weight of 373.24 g/mol. Its IUPAC name is 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid.

Molecular Properties

Compound Name2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid
PubChem CID61057559
Molecular FormulaC11H10Cl2O6S2
Molecular Weight373.24 g/mol
Exact Mass371.93
IUPAC Name2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid
SMILESO=C(O)c1cc(Cl)cc(S(=O)(=O)C2CCS(=O)(=O)C2)c1Cl
InChIInChI=1S/C11H10Cl2O6S2/c12-6-3-8(11(14)15)10(13)9(4-6)21(18,19)7-1-2-20(16,17)5-7/h3-4,7H,1-2,5H2,(H,14,15)
InChIKeyDMNXDIXKPQESCT-UHFFFAOYSA-N
XLogP1.65
TPSA105.58 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.24
LogP ≤ 51.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid?
The IUPAC name of 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid (CID 61057559) is 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid.
What is the SMILES notation for 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid?
The canonical SMILES for 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid is O=C(O)c1cc(Cl)cc(S(=O)(=O)C2CCS(=O)(=O)C2)c1Cl.
What is the InChIKey of 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid?
The InChIKey is DMNXDIXKPQESCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O6S2/c12-6-3-8(11(14)15)10(13)9(4-6)21(18,19)7-1-2-20(16,17)5-7/h3-4,7H,1-2,5H2,(H,14,15).
What are the key properties of 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid?
2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid has a molecular weight of 373.24 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3-(1,1-dioxothiolan-3-yl)sulfonylbenzoic acid is sourced from PubChem (CID 61057559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).