C13H16O6S2 — CID 61058790
3-(1,1-dioxothiolan-3-yl)sulfonyl-4,5-dimethylbenzoic acid (PubChem CID 61058790) has the molecular formula C13H16O6S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)sulfonyl-4,5-dimethylbenzoic acid.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)sulfonyl-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 61058790 |
| Molecular Formula | C13H16O6S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)sulfonyl-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)C2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C13H16O6S2/c1-8-5-10(13(14)15)6-12(9(8)2)21(18,19)11-3-4-20(16,17)7-11/h5-6,11H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | AXHCJFWGZDGSEI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |