5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid

C12H14O7S2 — CID 61058662

IUPAC5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid
SMILESCOc1ccc(S(=O)(=O)C2CCS(=O)(=O)C2)cc1C(=O)O
InChIInChI=1S/C12H14O7S2/c1-19-11-3-2-8(6-10(11)12(13)14)21(17,18)9-4-5-20(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14)
InChIKeyRXNZQEDCRIVFTO-UHFFFAOYSA-N
MW334.37 g/mol
LogP0.35
Rot. Bonds4

About 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid

5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid (PubChem CID 61058662) has the molecular formula C12H14O7S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid.

Molecular Properties

Compound Name5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid
PubChem CID61058662
Molecular FormulaC12H14O7S2
Molecular Weight334.37 g/mol
Exact Mass334.02
IUPAC Name5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid
SMILESCOc1ccc(S(=O)(=O)C2CCS(=O)(=O)C2)cc1C(=O)O
InChIInChI=1S/C12H14O7S2/c1-19-11-3-2-8(6-10(11)12(13)14)21(17,18)9-4-5-20(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14)
InChIKeyRXNZQEDCRIVFTO-UHFFFAOYSA-N
XLogP0.35
TPSA114.81 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.37
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid?
The IUPAC name of 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid (CID 61058662) is 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid.
What is the SMILES notation for 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid?
The canonical SMILES for 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid is COc1ccc(S(=O)(=O)C2CCS(=O)(=O)C2)cc1C(=O)O.
What is the InChIKey of 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid?
The InChIKey is RXNZQEDCRIVFTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7S2/c1-19-11-3-2-8(6-10(11)12(13)14)21(17,18)9-4-5-20(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14).
What are the key properties of 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid?
5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid has a molecular weight of 334.37 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid is sourced from PubChem (CID 61058662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).