C12H14O7S2 — CID 61058662
5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid (PubChem CID 61058662) has the molecular formula C12H14O7S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid.
| Compound Name | 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 61058662 |
| Molecular Formula | C12H14O7S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5-(1,1-dioxothiolan-3-yl)sulfonyl-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)C2CCS(=O)(=O)C2)cc1C(=O)O |
| InChI | InChI=1S/C12H14O7S2/c1-19-11-3-2-8(6-10(11)12(13)14)21(17,18)9-4-5-20(15,16)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | RXNZQEDCRIVFTO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |