C12H16N2O6S2 — CID 146024517
5-[(1,1-dioxothiolan-3-yl)sulfamoyl]-2-methoxybenzamide (PubChem CID 146024517) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)sulfamoyl]-2-methoxybenzamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)sulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 146024517 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)sulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1C(N)=O |
| InChI | InChI=1S/C12H16N2O6S2/c1-20-11-3-2-9(6-10(11)12(13)15)22(18,19)14-8-4-5-21(16,17)7-8/h2-3,6,8,14H,4-5,7H2,1H3,(H2,13,15) |
| InChIKey | OAOJBIMWQUDOKT-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |