C18H18FNO6S2 — CID 42364516
5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyphenyl)benzamide (PubChem CID 42364516) has the molecular formula C18H18FNO6S2 and a molecular weight of 427.48 g/mol. Its IUPAC name is 5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyphenyl)benzamide.
| Compound Name | 5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 42364516 |
| Molecular Formula | C18H18FNO6S2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1cc(S(=O)(=O)[C@H]2CCS(=O)(=O)C2)ccc1F |
| InChI | InChI=1S/C18H18FNO6S2/c1-26-17-5-3-2-4-16(17)20-18(21)14-10-12(6-7-15(14)19)28(24,25)13-8-9-27(22,23)11-13/h2-7,10,13H,8-9,11H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | HEXUNNNCQNGUAI-ZDUSSCGKSA-N |
| XLogP | 2.05 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |